
CAS 123399-69-9
:1,3-Dithiolane-2,4,5-trithione, homopolymer
Description:
1,3-Dithiolane-2,4,5-trithione, homopolymer, identified by CAS number 123399-69-9, is a synthetic polymer characterized by its unique dithiolane structure, which incorporates sulfur atoms within its cyclic framework. This compound exhibits properties typical of polysulfides, including potential applications in materials science and organic synthesis. The presence of multiple sulfur atoms contributes to its chemical reactivity, making it useful in various chemical transformations and as a precursor for other sulfur-containing compounds. The polymer's structure may impart interesting physical properties, such as flexibility and thermal stability, which can be advantageous in specific applications. Additionally, the compound's solubility and interaction with other materials can vary based on its molecular weight and degree of polymerization. Overall, 1,3-Dithiolane-2,4,5-trithione, homopolymer represents a class of materials with potential utility in fields ranging from pharmaceuticals to advanced materials, although detailed studies on its specific applications and behavior in various environments are necessary for a comprehensive understanding.
Formula:(C3S5)x
InChI:InChI=1S/C3S5/c4-1-2(5)8-3(6)7-1
InChI key:InChIKey=JUQVDMLKRDJLKQ-UHFFFAOYSA-N
SMILES:S=C1C(=S)SC(=S)S1
Synonyms:- 1,3-Dithiole-2,4,5-trithione oligomer
- 1,3-Dithiolane-2,4,5-trithione, homopolymer
- 1,3-Dithiole-2,4,5-trithione homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
