CymitQuimica logo

CAS 1234-21-5

:

1,3-bis(3-nitrophenyl)urea

Description:
1,3-bis(3-nitrophenyl)urea, with the CAS number 1234-21-5, is an organic compound characterized by its urea functional group and two nitrophenyl substituents. This compound typically appears as a solid and is known for its crystalline structure. The presence of nitro groups on the phenyl rings contributes to its potential as a synthetic intermediate in organic chemistry, particularly in the development of dyes and pharmaceuticals. The nitro groups also enhance the compound's electron-withdrawing properties, which can influence its reactivity and solubility in various solvents. Additionally, 1,3-bis(3-nitrophenyl)urea may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Its stability under standard conditions allows for various applications, although care should be taken due to the potential toxicity associated with nitro compounds. Overall, this compound serves as an important example of how modifications to a simple urea structure can lead to diverse chemical properties and applications.
Formula:C13H10N4O5
InChI:InChI=1/C13H10N4O5/c18-13(14-9-3-1-5-11(7-9)16(19)20)15-10-4-2-6-12(8-10)17(21)22/h1-8H,(H2,14,15,18)
Synonyms:
  • urea, N,N'-bis(3-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.