
CAS 1234-28-2
:N,N′-Bis(4-nitrophenyl)thiourea
Description:
N,N′-Bis(4-nitrophenyl)thiourea is an organic compound characterized by its thiourea functional group and two 4-nitrophenyl substituents. It typically appears as a yellow crystalline solid, reflecting the presence of the nitro groups, which are known to impart significant electron-withdrawing properties. This compound is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic rings. It exhibits notable chemical reactivity, particularly in nucleophilic substitution reactions, and can participate in various organic synthesis processes. The presence of nitro groups enhances its potential as a dye or pigment, as well as in applications related to pharmaceuticals and agrochemicals. Additionally, N,N′-Bis(4-nitrophenyl)thiourea can serve as a ligand in coordination chemistry, forming complexes with transition metals. Its properties make it a subject of interest in both academic research and industrial applications, particularly in the fields of materials science and medicinal chemistry. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C13H10N4O4S
InChI:InChI=1S/C13H10N4O4S/c18-16(19)11-5-1-9(2-6-11)14-13(22)15-10-3-7-12(8-4-10)17(20)21/h1-8H,(H2,14,15,22)
InChI key:InChIKey=OBKCWSBEZHAAMS-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=C(N(=O)=O)C=C1)=S)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Carbanilide, p,p′-dinitrothio-
- N,N′-Bis(4-nitrophenyl)thiourea
- Thiourea, N,N′-bis(4-nitrophenyl)-
- 1,3-Bis(p-nitrophenyl)thiourea
- Carbanilide, 4,4′-dinitrothio-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.