CAS 1234014-34-6

6-Bromo-N4-methyl-3,4-pyridinediamine

Description:

6-Bromo-N4-methyl-3,4-pyridinediamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 6-position and a methyl group at the N4 position contributes to its unique reactivity and potential applications in medicinal chemistry and material science. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with biological systems. The bromine substituent may also enhance its electrophilic character, making it a candidate for further chemical modifications. Additionally, the compound's structure suggests potential uses in the synthesis of more complex molecules or as a building block in drug development. Safety and handling precautions should be observed due to the presence of bromine and the potential for biological activity. As with any chemical, thorough characterization through techniques such as NMR, IR, and mass spectrometry is essential for confirming its identity and purity.

Formula: C₆H₈BrN₃

InChI: InChI=1S/C6H8BrN3/c1-9-5-2-6(7)10-3-4(5)8/h2-3H,8H2,1H3,(H,9,10)

InChI key: InChIKey=MNAFCHNZEMIAPI-UHFFFAOYSA-N

SMILES: N(C)C=1C(N)=CN=C(Br)C1

Synonyms:

• 6-Bromo-N4-methyl-3,4-pyridinediamine
• 3,4-Pyridinediamine, 6-bromo-N4-methyl-