CAS 1234015-52-1: 5-[[5-[2-(3-Aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]-2-pyrazinecarbonitrile
Description:5-[[5-[2-(3-Aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]-2-pyrazinecarbonitrile is a complex organic compound characterized by its multi-functional structure, which includes pyrazole and pyrazine moieties. This compound features a pyrazinecarbonitrile group, contributing to its potential biological activity. The presence of an amino group and a methoxyphenyl substituent suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The 3-aminopropoxy chain enhances its solubility and may influence its pharmacokinetic properties. The compound's molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which can affect its reactivity and stability. As with many compounds containing nitrogen heterocycles, it may exhibit diverse biological activities, including anti-inflammatory or anticancer properties, although specific biological data would be required for a comprehensive understanding. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, pending further research and characterization.
Formula:C18H19N7O2
InChI:InChI=1S/C18H19N7O2/c1-26-14-4-2-5-15(27-7-3-6-19)18(14)13-8-16(25-24-13)23-17-11-21-12(9-20)10-22-17/h2,4-5,8,10-11H,3,6-7,19H2,1H3,(H2,22,23,24,25)
InChI key:InChIKey=DOTGPNHGTYJDEP-UHFFFAOYSA-N
SMILES:N#CC1=NC=C(N=C1)NC2=NNC(=C2)C=3C(OC)=CC=CC3OCCCN
- Synonyms:
- 2-Pyrazinecarbonitrile, 5-[[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]-
- 5-[[5-[2-(3-Aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]-2-pyrazinecarbonitrile
- LY 2606368
- Prexasertib
![5-[[5-[2-(3-Aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]-2-pyrazinecarbonitrile](https://static.cymitquimica.com/cas-image/348796-5-5-2-3-aminopropoxy-6-methoxyphenyl-1h-pyrazol-3-yl-amino-2-pyrazinecarbonitrile.png)
