CAS 1234015-62-3
:1-[2-Methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylthio)-2-propen-1-one
Description:
1-[2-Methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylthio)-2-propen-1-one, identified by its CAS number 1234015-62-3, is an organic compound characterized by its complex structure, which includes multiple functional groups such as methoxy and methylthio groups. This compound is likely to exhibit properties typical of chalcones, which are known for their potential biological activities, including anti-inflammatory, antioxidant, and anticancer effects. The presence of methoxy groups can enhance lipophilicity, potentially influencing its solubility and bioavailability. Additionally, the methylthio substituents may contribute to its reactivity and interaction with biological targets. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its specific applications and efficacy would depend on further empirical studies, including pharmacological evaluations and toxicity assessments. Overall, this compound represents a class of organic molecules that may hold promise in medicinal chemistry and material science.
Formula:C20H22O4S2
InChI:InChI=1S/C20H22O4S2/c1-22-15-10-8-14(9-11-15)13-24-18-7-5-6-17(23-2)20(18)16(21)12-19(25-3)26-4/h5-12H,13H2,1-4H3
InChI key:InChIKey=BXRUQSDKXVQGKN-UHFFFAOYSA-N
SMILES:C(C=C(SC)SC)(=O)C1=C(OCC2=CC=C(OC)C=C2)C=CC=C1OC
Synonyms:- 2-Propen-1-one, 1-[2-methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylthio)-
- 1-(2-Methoxy-6-((4-Methoxybenzyl)Oxy)Phenyl)-3,3-Bis(Methylthio)Prop-2-En-1-One
- 1-[2-Methoxy-6-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylthio)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.