CAS 123402-20-0

3'-deoxy-3'-fluorocytidine

Description:

3'-Deoxy-3'-fluorocytidine is a modified nucleoside analog of cytidine, characterized by the substitution of a fluorine atom at the 3' position of the ribose sugar. This modification imparts unique properties to the molecule, influencing its biological activity and stability. The presence of the fluorine atom enhances the resistance of the nucleoside to enzymatic degradation, making it a valuable compound in medicinal chemistry, particularly in the development of antiviral and anticancer agents. As a nucleoside analog, it can interfere with nucleic acid synthesis and function, potentially leading to the inhibition of viral replication or cancer cell proliferation. The compound is typically studied for its incorporation into DNA or RNA, where it may affect base pairing and overall nucleic acid structure. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are crucial for evaluating its therapeutic potential. Overall, 3'-deoxy-3'-fluorocytidine represents an important tool in the field of nucleoside analog research and drug development.

Formula: C₉H₁₂FN₃O₄

InChI: InChI=1/C9H12FN3O4/c10-6-4(3-14)17-8(7(6)15)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6-,7-,8-/m1/s1

SMILES: c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)F)O)c(nc1=N)O

Cytidine, 3'-deoxy-3'-fluoro-

CAS: 123402-20-0

Formula: C₉H₁₂FN₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 245.2077

Ref: IN-DA000KJH

4-Amino-1-((2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one

CAS: 123402-20-0

4-Amino-1-((2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidin-2(1H)-one

Purity: 99%

Molecular weight: 245.21g/mol

Ref: 54-PC1006195

3'-Deoxy-3'-fluorocytidine

CAS: 123402-20-0

3'-Deoxy-3'-fluorocytidine is a nucleoside, fluoro-modified nucleoside.

Formula: C₉H₁₂FN₃O₄

Color and Shape: Solid

Molecular weight: 245.21

Ref: TM-TNU0006

3′-Fluoro-3′-deoxycytidine

CAS: 123402-20-0

Formula: C₉H₁₂FN₃O₄

Purity: 98%

Molecular weight: 245.21

Ref: 10-F230422

3'-Deoxy-3'-fluorocytidine

CAS: 123402-20-0

3'-Deoxy-3'-fluorocytidine is an activating agent that has been shown to inhibit coxsackie virus and other single-stranded RNA viruses. It is a nucleoside analogue that binds to the enzyme ribofuranoside, preventing the formation of the active site. 3'-Deoxy-3'-fluorocytidine has also been shown to inhibit the biochemical reactions involving S-adenosylhomocysteine hydrolase, which catalyzes the conversion of S-adenosylhomocysteine into adenosine, a precursor for DNA synthesis. Mechanistic studies have indicated that 3'-deoxy-3'-fluorocytidine inhibits enzymatic activity through stereochemical interactions with S-adenosylhomocysteine hydrolase.

Formula: C₉H₁₂FN₃O₄

Purity: Min. 95%

Molecular weight: 245.21 g/mol

Ref: 3D-ND15613