CAS 123402-21-1: 3fluoro-3deoxyguanosine
Description:3-Fluoro-3-deoxyguanosine is a modified nucleoside that serves as an analog of the natural nucleoside guanosine. Its chemical structure features a fluorine atom substituted at the 3-position of the sugar moiety, which is a deoxyribose, resulting in the absence of a hydroxyl group at this position. This modification can influence the nucleoside's biochemical properties, including its incorporation into nucleic acids and its interaction with enzymes involved in nucleic acid metabolism. The presence of the fluorine atom may enhance the stability of the nucleoside against enzymatic degradation and alter its base-pairing properties. 3-Fluoro-3-deoxyguanosine is of interest in medicinal chemistry and molecular biology, particularly in the development of antiviral and anticancer agents, as it can potentially interfere with nucleic acid synthesis and function. Its unique characteristics make it a valuable tool for studying nucleic acid processes and for designing novel therapeutic compounds.
Formula:C10H12FN5O4
InChI:InChI=1S/C10H12FN5O4/c11-4-3(1-17)20-9(6(4)18)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19)/t3-,4-,6-,9-/m1/s1
InChI key:InChIKey=VDOWHLFGBWKXJC-DXTOWSMRSA-N
SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(CO)C(F)C3O
- Synonyms:
- 3'-Deoxy-3'-Fluoroguanosine
- 3′-Fluoro-3′-deoxyguanosine
- 9-[3-Deoxy-3-C-Fluoro-Ss-D-Ribofuranosyl]Guanine
- 9-[3-Deoxy-3-C-fluoro-beta-D-ribofuranosyl]guanine
- 9-[3-deoxy-3-C-fluoro--D-ribofuranosyl]guanine cas:
- Guanosine, 3′-deoxy-3′-fluoro-
