CymitQuimica logo

CAS 123412-43-1

:

N-(2-Fluoropyridine-4-carbonyl)-L-proline

Description:
N-(2-Fluoropyridine-4-carbonyl)-L-proline is a chemical compound characterized by its unique structure, which includes a proline amino acid linked to a 2-fluoropyridine-4-carbonyl moiety. This compound features a pyridine ring substituted with a fluorine atom, which can influence its reactivity and biological activity. The presence of the carbonyl group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. As an amino acid derivative, it may exhibit properties typical of peptides, including potential interactions with biological targets, making it of interest in medicinal chemistry and drug design. The compound's solubility, stability, and reactivity can be affected by the fluorine substitution and the proline structure, which may also impart specific conformational characteristics. Overall, N-(2-Fluoropyridine-4-carbonyl)-L-proline represents a versatile building block for further chemical synthesis and exploration in pharmaceutical applications.
Formula:C11H11FN2O3
InChI:InChI=1/C11H11FN2O3/c12-9-6-7(3-4-13-9)10(15)14-5-1-2-8(14)11(16)17/h3-4,6,8H,1-2,5H2,(H,16,17)/t8-/m0/s1
SMILES:C1C[C@@H](C(=O)O)N(C1)C(=O)c1ccnc(c1)F
Synonyms:
  • 123412-43-1
  • (2S)-1-(2-fluoropyridine-4-carbonyl)pyrrolidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.