CAS 123421-05-6
:(8R)-8-ethyl-2,3,8-trimethyl-4H-chromene-4,7(8H)-dione
Description:
The chemical substance known as (8R)-8-ethyl-2,3,8-trimethyl-4H-chromene-4,7(8H)-dione, with the CAS number 123421-05-6, is a member of the chromene family, which is characterized by a fused benzene and pyran ring structure. This compound features multiple methyl and ethyl substituents, contributing to its unique structural and stereochemical properties. The presence of the diketone functional groups (4H-chromene-4,7(8H)-dione) indicates that it can participate in various chemical reactions, including oxidation and reduction processes. Its stereochemistry, denoted by the (8R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and natural product research. Additionally, the chromene derivatives are known for their potential applications in fields such as agriculture, where they may serve as natural pesticides or growth regulators. Overall, this compound's unique structure and functional groups position it as a subject of interest for further study in various scientific disciplines.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-5-14(4)11(15)7-6-10-12(16)8(2)9(3)17-13(10)14/h6-7H,5H2,1-4H3/t14-/m0/s1
Synonyms:- 4H-1-Benzopyran-4,7(8H)-dione, 8-ethyl-2,3,8-trimethyl-, (8R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Spiciferone A
CAS:Spiciferone A is a useful organic compound for research related to life sciences. The catalog number is T126175 and the CAS number is 123421-05-6.Formula:C14H16O3Color and Shape:SolidMolecular weight:232.279
