CAS 123427-77-0

bromo-[2-(2-methoxyphenyl)ethyl]magnesium

Description:

Bromo-[2-(2-methoxyphenyl)ethyl]magnesium, with the CAS number 123427-77-0, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. This specific Grignard reagent features a bromo group attached to a 2-(2-methoxyphenyl)ethyl moiety, indicating that it has both aromatic and aliphatic characteristics. The methoxy group contributes to the compound's electron-donating properties, which can influence its reactivity in nucleophilic addition reactions. Grignard reagents are typically used to form carbon-carbon bonds, making them valuable intermediates in the synthesis of alcohols, ketones, and other organic compounds. However, they are sensitive to moisture and air, requiring an anhydrous environment for storage and handling. Overall, bromo-[2-(2-methoxyphenyl)ethyl]magnesium is a versatile reagent in synthetic organic chemistry, enabling the construction of complex molecular architectures.

Formula: C₉H₁₁BrMgO

InChI: InChI=1/C9H11O.BrH.Mg/c1-3-8-6-4-5-7-9(8)10-2;;/h4-7H,1,3H2,2H3;1H;/q;;+1/p-1/rC9H11BrMgO/c1-12-9-5-3-2-4-8(9)6-7-11-10/h2-5H,6-7H2,1H3

SMILES: [CH2]Cc1ccccc1OC.Br.[Mg]

2-Methoxyphenethylmagnesium bromide, 0.50 M in THF

CAS: 123427-77-0

Formula: C₉H₁₁BrMgO

Molecular weight: 239.392

Ref: IN-DA000KJL