CymitQuimica logo

CAS 1234298-94-2

:

9-Methyl-9H-purine-8-carboxylic acid

Description:
9-Methyl-9H-purine-8-carboxylic acid, identified by its CAS number 1234298-94-2, is a purine derivative characterized by a methyl group at the 9-position and a carboxylic acid functional group at the 8-position of the purine ring. This compound is part of a class of molecules that play significant roles in biological systems, particularly in nucleic acid metabolism and cellular signaling. Its structure contributes to its potential interactions with various biological targets, making it of interest in pharmacological research. The presence of the carboxylic acid group suggests it may exhibit acidic properties, influencing its solubility and reactivity in different environments. Additionally, the methyl substitution can affect its biological activity and binding affinity to enzymes or receptors. Overall, 9-Methyl-9H-purine-8-carboxylic acid is a compound that may have implications in medicinal chemistry and biochemistry, warranting further investigation into its properties and potential applications.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c1-11-5-4(2-8-3-9-5)10-6(11)7(12)13/h2-3H,1H3,(H,12,13)
InChI key:InChIKey=VHJIIZISDQLNKE-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C(O)=O)=CN=CN2
Synonyms:
  • 9-Methyl-9H-purine-8-carboxylic acid
  • 9H-Purine-8-carboxylic acid, 9-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.