CAS 123437-25-2

Coelenterazine cp

Description:

Coelenterazine cp is a bioluminescent compound commonly used in biochemical research, particularly in studies involving luciferases, which are enzymes that catalyze bioluminescent reactions. This compound is a derivative of coelenterazine, a natural substrate found in various marine organisms, including certain jellyfish and deep-sea creatures. Coelenterazine cp is characterized by its ability to emit light when oxidized in the presence of oxygen and luciferase, making it valuable for applications in bioluminescent imaging and assays. The compound typically exhibits a high degree of stability under physiological conditions, allowing for reliable experimental results. Its light emission is often measured in terms of intensity and wavelength, which can vary depending on the specific luciferase used. Additionally, coelenterazine cp is soluble in organic solvents and has a relatively low molecular weight, facilitating its use in various laboratory settings. Overall, its unique properties make it an essential tool in molecular biology and biochemistry for studying cellular processes and gene expression.

Formula: C₂₅H₂₅N₃O₃

InChI: InChI=1/C25H25N3O3/c29-19-9-5-17(6-10-19)14-22-25(31)28-15-23(18-7-11-20(30)12-8-18)26-21(24(28)27-22)13-16-3-1-2-4-16/h5-12,15-16,26,29-30H,1-4,13-14H2

SMILES: C1CCC(C1)Cc1c2nc(Cc3ccc(cc3)O)c(=O)n2cc(c2ccc(cc2)O)[nH]1

Synonyms:

• CTZ cp
• Clzn-Cp
• 2-[(4-Hydroxyphenyl)Methyl]-6-(4-Hydroxyphenyl)-8-(Cyclopenylmethyl)-Imdazo[1,2-A]Pyrazin-3-(7H)-One
• 8-(cyclopentylmethyl)-2-(4-hydroxybenzyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one

Coelenterazine cp

CAS: 123437-25-2

Coelenterazine cp is a coelenterazine analog for Renilla luciferase. In certain studies, it has been shown to be highly sensitive for the detection of human papilloma virus (HPV) and can be used in the diagnosis of cervical cancer.

Formula: C₂₅H₂₅N₃O₃

Purity: Min. 95%

Molecular weight: 415.48 g/mol

Ref: 3D-FC36334