CymitQuimica logo

CAS 123437-32-1

:

COELENTERAZINE HCP

Description:
Coelenterazine HCP, with the CAS number 123437-32-1, is a bioluminescent compound primarily derived from marine organisms, particularly those in the phylum Cnidaria, such as jellyfish. This compound is a luciferin, which means it plays a crucial role in the bioluminescence process, where it reacts with oxygen in the presence of a specific enzyme called luciferase to produce light. Coelenterazine HCP is characterized by its unique chemical structure, which includes a fused ring system that contributes to its luminescent properties. It is soluble in organic solvents and exhibits fluorescence under certain conditions. This compound is widely used in biochemical research, particularly in assays and imaging techniques, due to its ability to emit light, allowing for sensitive detection of biological processes. Its applications extend to areas such as molecular biology, drug discovery, and environmental monitoring, making it a valuable tool in scientific research.
Formula:C25H25N3O2
InChI:InChI=1/C25H25N3O2/c29-20-12-10-19(11-13-20)23-16-28-24(21(26-23)14-17-8-4-5-9-17)27-22(25(28)30)15-18-6-2-1-3-7-18/h1-3,6-7,10-13,16-17,26,29H,4-5,8-9,14-15H2
SMILES:c1ccc(cc1)Cc1c(=O)n2cc(c3ccc(cc3)O)[nH]c(CC3CCCC3)c2n1
Synonyms:
  • Imidazo[1,2-A]Pyrazin-3(7H)-One, 8-(Cyclopentylmethyl)-6-(4-Hydroxyphenyl)-2-(Phenylmethyl)-
  • Clz-Hcp
  • Clzn-Hcp
  • Coelenterazine-Hcp, Synthetic
  • 2-Benzyl-6-(P-Hydroxyphenyl)-8-Cyclopentylmethylimidazo[1,2-A]Pyrazin-3-(7H)-One
  • 2-benzyl-8-(cyclopentylmethyl)-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3(7H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.