CAS 123439-80-5

copper(ii) phthalocyanine-3,4',4'',4'''-tetrasulf

Description:

Copper(II) phthalocyanine-3,4',4'',4'''-tetrasulfonic acid, commonly referred to as copper phthalocyanine tetrasulfonic acid, is a synthetic organic compound notable for its vibrant blue-green color and high stability. It belongs to the phthalocyanine family, which are large, planar, aromatic compounds characterized by their ability to form coordination complexes with metals. This particular compound features four sulfonic acid groups, which enhance its solubility in water and polar solvents, making it useful in various applications, including dyes, pigments, and as a colorant in inks and coatings. The presence of copper in its structure contributes to its unique electronic properties, allowing it to be utilized in electronic applications, such as organic semiconductors. Additionally, copper phthalocyanine tetrasulfonic acid exhibits excellent thermal and photochemical stability, making it suitable for use in environments where durability is essential. Its environmental impact is generally low, but like many synthetic dyes, it should be handled with care to avoid potential ecological effects.

Formula: C₃₂H₁₆CuN₈O₁₂S₄

InChI: InChI=1/C32H16N8O12S4.Cu/c41-53(42,43)13-4-7-16-20(10-13)29-33-25(16)35-30-22-12-15(55(47,48)49)6-9-18(22)27(37-30)39-32-24-19(2-1-3-23(24)56(50,51)52)28(40-32)38-31-21-11-14(54(44,45)46)5-8-17(21)26(34-29)36-31;/h1-12H,(H4-2,33,34,35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50,51,52);/q-2;+2

SMILES: c1cc2c(c(c1)S(=O)(=O)O)C1=NC3=NC(=Nc4c5ccc(cc5c([n-]4)[N-]C4=NC(=NC2=N1)c1cc(ccc41)S(=O)(=O)O)S(=O)(=O)O)c1cc(ccc31)S(=O)(=O)O.[Cu]

Synonyms:

• Copper(II) phthalocyanine-tetrasulfonic acid tetrasodium salt
• Copper(2+) 2,9,15,23-Tetrasulfophthalocyanine-29,30-Diide