CAS 123442-26-2
:myricomplanoside
Description:
Myricomplanoside, with the CAS number 123442-26-2, is a glycoside compound derived from the Myrica genus of plants. It is characterized by its complex structure, which typically includes a sugar moiety linked to a phenolic aglycone. This compound is known for its potential biological activities, including antioxidant properties, which may contribute to its role in traditional medicine. Myricomplanoside has been studied for its effects on various biological systems, indicating potential therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its practical use in formulations. Additionally, the compound's interaction with other substances can influence its efficacy and bioavailability. As with many natural products, further research is necessary to fully elucidate its mechanisms of action and potential health benefits. Overall, myricomplanoside represents a fascinating area of study within phytochemistry and pharmacognosy.
Formula:C22H22O13
InChI:InChI=1/C22H22O13/c1-32-11-2-7(21-19(30)17(28)14-9(25)4-8(24)5-10(14)33-21)3-12(15(11)26)34-22-20(31)18(29)16(27)13(6-23)35-22/h2-5,13,16,18,20,22-27,29-31H,6H2,1H3/t13-,16-,18+,20-,22-/m1/s1
Synonyms:- 4H-1-Benzopyran-4-one, 2-(3-(beta-D-glucopyranosyloxy)-4-hydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-
- 2-hydroxy-3-methoxy-5-(3,5,7-trihydroxy-4-oxo-4H-chromen-2-yl)phenyl beta-D-glucopyranoside
- Myricomplanoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Isorhamnetin-5-O-methyl ether-3-glucoside
CAS:<p>Isorhamnetin-5-O-methyl ether-3-glucoside is a flavonoid glycoside, which is a secondary metabolite typically found in various plant sources such as fruits, vegetables, and certain herbs. It is part of a larger class of compounds known as flavonoids, which are well-known for their diverse biological activities. The mode of action of Isorhamnetin-5-O-methyl ether-3-glucoside primarily involves its antioxidant properties, which allow it to neutralize free radicals and reduce oxidative stress.</p>Formula:C22H22O13Purity:Min. 95%Molecular weight:494.4 g/mol
