CymitQuimica logo

CAS 1234474-58-8

:

Methyl (3R)-2,3-dihydro-6-hydroxy-3-benzofuranacetate

Description:
Methyl (3R)-2,3-dihydro-6-hydroxy-3-benzofuranacetate is a chemical compound characterized by its unique structural features, which include a benzofuran moiety and an ester functional group. This compound is typically classified as an organic ester, derived from the reaction of a benzofuran derivative with acetic acid or its derivatives. The presence of the hydroxyl group contributes to its potential reactivity and solubility in various solvents. The stereochemistry indicated by the (3R) designation suggests that it has specific spatial arrangements that may influence its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the molecular structure may allow for various functionalization possibilities, which can be explored for synthetic applications or in the development of new materials. Overall, Methyl (3R)-2,3-dihydro-6-hydroxy-3-benzofuranacetate represents a class of compounds that can be significant in both research and industrial contexts.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-14-11(13)4-7-6-15-10-5-8(12)2-3-9(7)10/h2-3,5,7,12H,4,6H2,1H3/t7-/m0/s1
InChI key:InChIKey=RHMDISFJOKCCAQ-ZETCQYMHSA-N
SMILES:C(C(OC)=O)[C@@H]1C=2C(OC1)=CC(O)=CC2
Synonyms:
  • 3-Benzofuranacetic acid, 2,3-dihydro-6-hydroxy-, methyl ester, (3R)-
  • ((R)-6-Hydroxy-2,3-dihydrobenzofuran-3-yl)acetic acid methyl ester
  • Methyl (3R)-2,3-dihydro-6-hydroxy-3-benzofuranacetate
Found 4 products.