CAS 1234490-83-5
:N-(2′-C-Methyl-6-O-methyl-P-1-naphthalenyl-5′-guanylyl)-L-alanine 2,2-dimethylpropyl ester
Description:
N-(2′-C-Methyl-6-O-methyl-P-1-naphthalenyl-5′-guanylyl)-L-alanine 2,2-dimethylpropyl ester is a synthetic compound that belongs to a class of molecules known for their potential biological activity, particularly in the context of signaling pathways. This compound features a guanylyl group, which is often involved in cellular signaling, and a naphthalene moiety that may contribute to its hydrophobic characteristics and potential interactions with biological membranes. The presence of the L-alanine residue suggests that it may interact with biological systems in a manner similar to amino acids, potentially influencing protein interactions or enzymatic activity. The 2,2-dimethylpropyl ester group indicates that the compound may exhibit lipophilic properties, which can affect its solubility and permeability in biological environments. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry or biochemistry, although specific biological activities and mechanisms would require further investigation.
Formula:C30H39N6O9P
InChI:InChI=1S/C30H39N6O9P/c1-17(26(38)42-15-29(2,3)4)35-46(40,45-20-13-9-11-18-10-7-8-12-19(18)20)43-14-21-23(37)30(5,39)27(44-21)36-16-32-22-24(36)33-28(31)34-25(22)41-6/h7-13,16-17,21,23,27,37,39H,14-15H2,1-6H3,(H,35,40)(H2,31,33,34)/t17-,21+,23+,27+,30+,46?/m0/s1
InChI key:InChIKey=YFXGICNMLCGLHJ-RSKRLRQZSA-N
SMILES:C[C@]1(O)[C@H](N2C=3C(N=C2)=C(OC)N=C(N)N3)O[C@H](COP(OC=4C5=C(C=CC4)C=CC=C5)(N[C@H](C(OCC(C)(C)C)=O)C)=O)[C@H]1O
Synonyms:- BMS 986094
- N-(2′-C-Methyl-6-O-methyl-P-1-naphthalenyl-5′-guanylyl)-L-alanine 2,2-dimethylpropyl ester
- INX 08189
- L-Alanine, N-(2′-C-methyl-6-O-methyl-P-1-naphthalenyl-5′-guanylyl)-, 2,2-dimethylpropyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Alanine, N-(2'-C-methyl-6-O-methyl-P-1-naphthalenyl-5'-guanylyl)-, 2,2-dimethylpropyl ester
CAS:Formula:C30H39N6O8PPurity:99.90%Color and Shape:SolidMolecular weight:642.6398BMS 986094 hydrate
CAS:BMS 986094 hydrate is an investigational nucleotide analog that targets the hepatitis C virus (HCV). This compound is a derivative of an active moiety sourced from synthetic chemical libraries and is designed to be an NS5B polymerase inhibitor. Its mode of action involves the incorporation into the viral RNA chain by the NS5B polymerase, leading to premature chain termination and the subsequent inhibition of viral replication. BMS 986094 hydrate was researched primarily for its potential applications in treating chronic Hepatitis C infections, aiming to reduce viral load in infected individuals.Formula:C30H39N6O9P•(H2O)0Purity:Min. 95%Color and Shape:PowderMolecular weight:658.65 g/molBMS-986094
CAS:INX 08189 is an RNA-directed RNA polymerase (NS5B) inhibitor.Formula:C30H39N6O9PColor and Shape:SolidMolecular weight:658.64



