CAS 123457-83-0
:4-(MALEINIMIDO)PHENYL ISOCYANATE
Description:
4-(Maleinimido)phenyl isocyanate is a chemical compound characterized by its isocyanate functional group, which is known for its reactivity, particularly in forming urethane linkages. This compound features a maleimide moiety, which contributes to its ability to undergo Michael addition reactions, making it useful in various applications, including bioconjugation and polymer chemistry. The presence of the phenyl group enhances its stability and solubility in organic solvents. Typically, isocyanates are highly reactive and can react with nucleophiles, such as amines and alcohols, leading to the formation of stable urea or urethane products. This compound is often utilized in the synthesis of advanced materials and in the development of functionalized polymers. Safety precautions are essential when handling this substance, as isocyanates can be hazardous, causing respiratory irritation and sensitization. Overall, 4-(maleinimido)phenyl isocyanate is a versatile reagent in organic synthesis and materials science, valued for its unique reactivity and functionalization potential.
Formula:C11H6N2O3
InChI:InChI=1/C11H6N2O3/c14-7-12-8-1-3-9(4-2-8)13-10(15)5-6-11(13)16/h1-6H
SMILES:c1cc(ccc1N=C=O)N1C(=O)C=CC1=O
Synonyms:- 1H-Pyrrole-2,5-dione, 1-(4-isocyanatophenyl)-
- 1-(4-isocyanatophenyl)-1H-pyrrole-2,5-dione
- N-(p-MaleiMidophenyl)isocyanate(PMPI)
- 1H-Pyrrole-2,5-dione,1-(4-isocyanatophenyl)-(9CI)
- 4-(MALEINIMIDO)PHENYL ISOCYANATE 97+%
- PMPI (p-maleimidophenyl isocyanate)
- Isocyanic Acid 4-Maleimidophenyl Ester
- p-MaleiMidophenyl isocynate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Maleimidophenyl Isocyanate
CAS:Formula:C11H6N2O3Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:214.181H-Pyrrole-2,5-dione, 1-(4-isocyanatophenyl)-
CAS:Formula:C11H6N2O3Purity:95%Color and Shape:SolidMolecular weight:214.17694-Maleimidophenyl isocyanate
CAS:4-Maleimidophenyl isocyanateColor and Shape:SolidMolecular weight:214.18g/molp-Maleimidophenylisocyanate
CAS:Formula:C11H6N2O3Purity:95%Color and Shape:SolidMolecular weight:214.18p-Maleimidophenylisocyanate
CAS:p-Maleimidophenylisocyanate is a heterobifunctional cross-linking agent that reacts with amines and thiols. It has been used in biochemical applications, including the immobilization of proteins on supports such as magnetic beads or paramagnetic particles. p-Maleimidophenylisocyanate has also been used to prepare human cervical carcinoma cells for study by magnetic resonance spectroscopy. This compound can react with terminal amino groups or free sulfhydryl groups to form covalent bonds. The reactions are reversible, so the chemical reactions can be stopped at any time by removing the reagents from the reaction mixture.Formula:C11H6N2O3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:214.18 g/mol




