CAS 1234576-82-9
:(3S)-3-(Methylsulfonyl)piperidine
Description:
(3S)-3-(Methylsulfonyl)piperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a methylsulfonyl group at the 3-position of the piperidine ring imparts unique chemical properties, including increased polarity and potential for hydrogen bonding. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents, which enhances its utility in various chemical reactions and applications. The methylsulfonyl group can participate in nucleophilic substitution reactions, making this compound valuable in synthetic organic chemistry. Additionally, the stereochemistry indicated by the (3S) designation suggests that it has specific spatial arrangements that may influence its biological activity and interactions with other molecules. Overall, (3S)-3-(Methylsulfonyl)piperidine is of interest in medicinal chemistry and drug development due to its potential pharmacological properties.
Formula:C6H13NO2S
InChI:InChI=1S/C6H13NO2S/c1-10(8,9)6-3-2-4-7-5-6/h6-7H,2-5H2,1H3/t6-/m0/s1
InChI key:InChIKey=PBJLJPZGBKCUKM-LURJTMIESA-N
SMILES:S(C)(=O)(=O)[C@H]1CCCNC1
Synonyms:- (3S)-3-(Methylsulfonyl)piperidine
- Piperidine, 3-(methylsulfonyl)-, (3S)-
- (S)-3-(Methylsulfonyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.