CymitQuimica logo

CAS 1234615-76-9

:

7H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, methyl ester

Description:
7H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, methyl ester, is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, reflecting its polar functional groups. The presence of the carboxylic acid and methyl ester functional groups suggests it may participate in various chemical reactions, such as esterification and hydrolysis. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Additionally, its CAS number, 1234615-76-9, provides a unique identifier for regulatory and safety information. Overall, this compound's structural features and functional groups position it as a versatile molecule in both synthetic and biological chemistry contexts.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-13-8(12)6-3-10-7-5(6)2-9-4-11-7/h2-4H,1H3,(H,9,10,11)
InChI key:InChIKey=FEHWBWCQKKRFGX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NC1)=NC=NC2
Synonyms:
  • Methyl 7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate
  • 7H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, methyl ester
Found 4 products.