CymitQuimica logo

CAS 1234615-92-9

:

6-Bromo-4-chloro-1,8-naphthyridine-3-carbonitrile

Description:
6-Bromo-4-chloro-1,8-naphthyridine-3-carbonitrile is a heterocyclic organic compound characterized by its naphthyridine core, which features both bromine and chlorine substituents. The presence of the cyano group (-C≡N) at the 3-position contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically used in medicinal chemistry and material science due to its biological activity and ability to serve as a building block for more complex molecules. Its structural features suggest potential interactions with biological targets, making it of interest in drug discovery. Additionally, the halogen substituents can influence the compound's solubility, stability, and electronic properties, which are crucial for its performance in synthetic applications. Safety and handling precautions should be observed due to the presence of halogens and the cyano group, which can pose health risks. Overall, 6-Bromo-4-chloro-1,8-naphthyridine-3-carbonitrile is a versatile compound with significant implications in both research and industrial contexts.
Formula:C9H3BrClN3
InChI:InChI=1S/C9H3BrClN3/c10-6-1-7-8(11)5(2-12)3-13-9(7)14-4-6/h1,3-4H
InChI key:InChIKey=NNMBKEMIEHGWPL-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC1C#N)N=CC(Br)=C2
Synonyms:
  • 6-Bromo-4-chloro-1,8-naphthyridine-3-carbonitrile
  • 1,8-Naphthyridine-3-carbonitrile, 6-bromo-4-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.