CAS 1234616-01-3

methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Description:

Methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features an amino group at the 5-position and a carboxylate ester at the 3-position, contributing to its potential reactivity and biological activity. The methyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, which may be relevant in medicinal chemistry. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, its structural features may confer specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Overall, methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylate represents a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-14-9(13)7-4-12-8-6(7)2-5(10)3-11-8/h2-4H,10H2,1H3,(H,11,12)

InChI key: InChIKey=CULRUGBWHKMLGM-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NC1)=NC=C(N)C2

Synonyms:

• Methyl 5-aMino-7-azaindole-3-carboxylate
• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-amino-, methyl ester
• methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-amino-, methyl ester

CAS: 1234616-01-3

Formula: C₉H₉N₃O₂

Purity: 95%

Molecular weight: 191.1867

Ref: IN-DA000KLK

Methyl 5-amino-7-azaindole-3-carboxylate

CAS: 1234616-01-3

Methyl 5-amino-7-azaindole-3-carboxylate

Molecular weight: 191.18666g/mol

Ref: 54-OR1022234

Methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

CAS: 1234616-01-3

Formula: C₉H₉N₃O₂

Purity: 95%

Molecular weight: 191.19

Ref: 10-F465219