CymitQuimica logo

CAS 1234616-10-4

:

Ethyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate

Description:
Ethyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a bromine substituent at the 4-position of the pyrrole ring and an ethyl ester functional group at the carboxylic acid position. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical transformations and applications in medicinal chemistry. The ethyl ester group contributes to its solubility in organic solvents, facilitating its use in synthetic processes. Additionally, the compound may exhibit biological activity due to its structural similarity to other nitrogen-containing heterocycles, which are often found in pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Overall, Ethyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate is a versatile compound with significant implications in organic synthesis and medicinal applications.
Formula:C10H9BrN2O2
InChI:InChI=1S/C10H9BrN2O2/c1-2-15-10(14)6-3-13-8-5-12-4-7(11)9(6)8/h3-5,13H,2H2,1H3
InChI key:InChIKey=COOMIISIYBCQOA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NC1)=CN=CC2Br
Synonyms:
  • Ethyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate
  • 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 4-bromo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.