CAS 1234616-41-1

7-Quinazolinecarboxylic acid

Description:

7-Quinazolinecarboxylic acid is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. This compound features a carboxylic acid functional group at the 7-position of the quinazoline ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmaceutical research, as quinazoline derivatives are known for their biological activities, including potential anti-cancer and anti-inflammatory properties. Additionally, 7-Quinazolinecarboxylic acid can serve as a building block in the synthesis of more complex molecules. Its reactivity is influenced by the electron-withdrawing nature of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, this compound is significant in both synthetic and medicinal chemistry contexts.

Formula: C₉H₆N₂O₂

InChI: InChI=1S/C9H6N2O2/c12-9(13)6-1-2-7-4-10-5-11-8(7)3-6/h1-5H,(H,12,13)

InChI key: InChIKey=SRKXVESHUPPYMO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(C=C1)C=NC=N2

Synonyms:

• 7-Quinazolinecarboxylic acid

7-Quinazolinecarboxylic acid

CAS: 1234616-41-1

Formula: C₉H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.1561

Ref: IN-DA000KNJ

Quinazoline-7-carboxylic acid

CAS: 1234616-41-1

Quinazoline-7-carboxylic acid

Purity: 97%

Molecular weight: 174.16g/mol

Ref: 54-OR87761

QUINAZOLINE-7-CARBOXYLIC ACID

CAS: 1234616-41-1

Formula: C₉H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 174.159

Ref: 10-F467312

Quinazoline-7-carboxylic Acid

Controlled Product

CAS: 1234616-41-1

Applications Quinazoline-7-carboxylic Acid is a derivative of Quinazoline (Q670100) which is used to study the electrochemical behaviour of quinazoline using modern polarographic and voltammetric methods. Quinazoline is the basic structural unit of pharmaceuticals and plays an important role in modern synthesis of antitumor drugs.
References Hladikova, J., et al.: Sensing in Electroanal., 3, 165 (2008); Kurogi, Y., et al.: J. Med. Chem., 39, 1433 (1996)

Formula: C₉H₆N₂O₂

Color and Shape: Neat

Molecular weight: 174.16

Ref: TR-Q670105