
CAS 1234616-49-9
:4-Chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high lipophilicity due to its aromatic structure, which can influence its solubility in organic solvents. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing effects of the halogen atoms. Additionally, the methyl group at the 2-position can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. As a result, 4-Chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such structural features are often associated with enhanced biological activity.
Formula:C8H6ClFN2
InChI:InChI=1S/C8H6ClFN2/c1-4-2-5-7(9)6(10)3-11-8(5)12-4/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=IUUCGVQZEADVHH-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(C)=C2)=NC=C1F
Synonyms:- 4-Chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-fluoro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
