
CAS 1234616-52-4
:2,3-Dimethyl-2H-indazole-6-methanamine
Description:
2,3-Dimethyl-2H-indazole-6-methanamine is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The presence of two methyl groups at the 2 and 3 positions of the indazole ring contributes to its unique properties, while the methanamine group at the 6 position introduces basic amine functionality. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the presence of multiple functional groups may influence its solubility, stability, and reactivity. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling considerations are essential, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c1-7-9-4-3-8(6-11)5-10(9)12-13(7)2/h3-5H,6,11H2,1-2H3
InChI key:InChIKey=YSWKWJOUVUVEMI-UHFFFAOYSA-N
SMILES:CC1=C2C(C=C(CN)C=C2)=NN1C
Synonyms:- 2,3-Dimethyl-2H-indazole-6-methanamine
- 2H-Indazole-6-methanamine, 2,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.