CAS 1234616-54-6

Ethyl 6-chloropyrazolo[1,5-a]pyridine-2-carboxylate

Description:

Ethyl 6-chloropyrazolo[1,5-a]pyridine-2-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazolo-pyridine framework. This compound features a chlorinated position at the 6th carbon of the pyrazole ring, contributing to its reactivity and potential biological activity. The ethyl ester functional group at the 2-position enhances its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the carboxylate group suggests potential for further functionalization, allowing for the development of derivatives with tailored properties. Ethyl 6-chloropyrazolo[1,5-a]pyridine-2-carboxylate may exhibit interesting pharmacological activities, making it a candidate for research in medicinal chemistry. Its molecular structure and functional groups can influence its interactions with biological targets, potentially leading to applications in drug discovery. As with many compounds in this class, safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₀H₉ClN₂O₂

InChI: InChI=1S/C10H9ClN2O2/c1-2-15-10(14)9-5-8-4-3-7(11)6-13(8)12-9/h3-6H,2H2,1H3

InChI key: InChIKey=FZLIKESWMDCRJK-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NN2C(=C1)C=CC(Cl)=C2

Synonyms:

• Ethyl 6-chloropyrazolo[1,5-a]pyridine-2-carboxylate
• Pyrazolo[1,5-a]pyridine-2-carboxylic acid, 6-chloro-, ethyl ester