CymitQuimica logo

CAS 1234616-55-7

:

Methyl 3-[[(phenylmethoxy)carbonyl]amino]cyclobutanecarboxylate

Description:
Methyl 3-[[(phenylmethoxy)carbonyl]amino]cyclobutanecarboxylate is a chemical compound characterized by its complex structure, which includes a cyclobutane ring, an amino group, and an ester functional group. The presence of the phenylmethoxy group suggests that it has aromatic characteristics, contributing to its stability and potential reactivity. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (aromatic) and hydrophilic (carboxylate and amino) functional groups. Its molecular structure may allow for various interactions, including hydrogen bonding, which can influence its solubility in different solvents. The compound's potential applications could span across medicinal chemistry, particularly in drug design, due to the presence of the amino and ester functionalities, which are often involved in biological activity. Additionally, the cyclobutane ring may impart unique conformational properties that could affect its reactivity and interaction with biological targets. Overall, this compound represents a fascinating example of organic synthesis with potential implications in various fields of chemistry and pharmacology.
Formula:C14H17NO4
InChI:InChI=1S/C14H17NO4/c1-18-13(16)11-7-12(8-11)15-14(17)19-9-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3,(H,15,17)
InChI key:InChIKey=BVVKYBGQHKBKQR-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(NC(OCC2=CC=CC=C2)=O)C1
Synonyms:
  • Cyclobutanecarboxylic acid, 3-[[(phenylmethoxy)carbonyl]amino]-, methyl ester
  • Methyl 3-[[(phenylmethoxy)carbonyl]amino]cyclobutanecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.