CAS 1234616-57-9
:4-(Aminomethyl)-1-methyl-2-piperidinone
Description:
4-(Aminomethyl)-1-methyl-2-piperidinone, identified by its CAS number 1234616-57-9, is a chemical compound characterized by its piperidinone structure, which includes a piperidine ring with a methyl group and an aminomethyl substituent. This compound typically exhibits properties associated with amines and ketones, such as basicity due to the presence of the amino group and potential reactivity in nucleophilic addition reactions. It is often utilized in organic synthesis and pharmaceutical applications, particularly in the development of biologically active molecules. The presence of the piperidinone moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Safety data should be reviewed to understand its handling and potential hazards, as with any chemical substance.
Formula:C7H14N2O
InChI:InChI=1S/C7H14N2O/c1-9-3-2-6(5-8)4-7(9)10/h6H,2-5,8H2,1H3
InChI key:InChIKey=MKWVHTNYTUGQGA-UHFFFAOYSA-N
SMILES:C(N)C1CC(=O)N(C)CC1
Synonyms:- 4-(Aminomethyl)-1-methyl-2-piperidinone
- 2-Piperidinone, 4-(aminomethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Aminomethyl-1-methyl-2-piperidone
CAS:4-Aminomethyl-1-methyl-2-piperidone
Molecular weight:142.19886g/mol

