
CAS 1234616-59-1
:2,3-Dimethyl-2H-indazole-5-carbonitrile
Description:
2,3-Dimethyl-2H-indazole-5-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two methyl groups at the 2 and 3 positions of the indazole ring contributes to its unique properties, influencing its reactivity and solubility. The carbonitrile functional group at the 5 position introduces a polar character, enhancing its potential for hydrogen bonding and interactions with other molecules. This compound is typically used in medicinal chemistry and research due to its potential biological activity. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in the development of pharmaceuticals. Additionally, the compound's stability and solubility in organic solvents are important characteristics that facilitate its use in laboratory settings. Overall, 2,3-Dimethyl-2H-indazole-5-carbonitrile is notable for its structural features and potential applications in drug discovery and development.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c1-7-9-5-8(6-11)3-4-10(9)12-13(7)2/h3-5H,1-2H3
InChI key:InChIKey=YWJXXAQWFGIMIG-UHFFFAOYSA-N
SMILES:CC1=C2C(=NN1C)C=CC(C#N)=C2
Synonyms:- 2H-Indazole-5-carbonitrile, 2,3-dimethyl-
- 2,3-Dimethyl-2H-indazole-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.