CAS 1234616-63-7

2,3-Dimethyl-2H-indazole-5-methanol

Description:

2,3-Dimethyl-2H-indazole-5-methanol is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The presence of two methyl groups at the 2 and 3 positions of the indazole ring contributes to its unique properties, while the hydroxymethyl group at the 5 position enhances its reactivity and potential for hydrogen bonding. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxymethyl group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been explored for various biological activities. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral data (NMR, IR, etc.), would be essential for further characterization and application in research. Safety data should also be consulted to ensure proper handling and usage in laboratory settings.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1S/C10H12N2O/c1-7-9-5-8(6-13)3-4-10(9)11-12(7)2/h3-5,13H,6H2,1-2H3

InChI key: InChIKey=RDISLGCWUMWSQR-UHFFFAOYSA-N

SMILES: CC1=C2C(=NN1C)C=CC(CO)=C2

Synonyms:

• 2H-Indazole-5-methanol, 2,3-dimethyl-
• 2,3-Dimethyl-2H-indazole-5-methanol

(2,3-Dimethyl-2H-indazol-5-yl)methanol

CAS: 1234616-63-7

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₂O

Purity: Min. 95%

Molecular weight: 176.21 g/mol

Ref: 3D-JZB61663