
CAS 1234616-69-3
:6-Bromo-2-methyl-1(2H)-phthalazinone
Description:
6-Bromo-2-methyl-1(2H)-phthalazinone is a chemical compound characterized by its unique structure, which includes a phthalazinone core with a bromine atom and a methyl group substituent. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science. The compound may also exhibit biological activity, which can be explored for medicinal chemistry purposes. As with many brominated compounds, it is essential to consider its environmental impact and toxicity, particularly in terms of persistence and bioaccumulation. Overall, 6-Bromo-2-methyl-1(2H)-phthalazinone represents a versatile building block in organic synthesis and research.
Formula:C9H7BrN2O
InChI:InChI=1S/C9H7BrN2O/c1-12-9(13)8-3-2-7(10)4-6(8)5-11-12/h2-5H,1H3
InChI key:InChIKey=QPZLKCUSYJEWSQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Br)=CC2)C=NN1C
Synonyms:- 6-Bromo-2-methyl-1(2H)-phthalazinone
- 1(2H)-Phthalazinone, 6-bromo-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.