CAS 1234616-70-6

6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine

Description:

6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may be limited due to its hydrophobic nature. It is often utilized in medicinal chemistry and research due to its potential as a pharmacophore in drug development, particularly in targeting specific biological pathways. The compound's structure allows for various interactions with biological macromolecules, making it a candidate for further investigation in therapeutic applications. Additionally, its stability under standard laboratory conditions is a notable characteristic, although it may be sensitive to strong acids or bases. Overall, 6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₇H₂BrCl₂N₃

InChI: InChI=1S/C7H2BrCl2N3/c8-3-1-4-5(9)12-7(10)13-6(4)11-2-3/h1-2H

InChI key: InChIKey=VPAHKVLQMKEPQW-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(Cl)N1)N=CC(Br)=C2

Synonyms:

• 6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine
• Pyrido[2,3-d]pyrimidine, 6-bromo-2,4-dichloro-

Pyrido[2,3-d]pyrimidine, 6-bromo-2,4-dichloro-

CAS: 1234616-70-6

Formula: C₇H₂BrCl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 278.9209

Ref: IN-DA000KN6

6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine

CAS: 1234616-70-6

6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 278.92g/mol

Ref: 54-OR1033605

6-Bromo-2,4-dichloropyrido[2,3-d]pyrimidine

CAS: 1234616-70-6

Formula: C₇H₂BrCl₂N₃

Purity: 97%

Molecular weight: 278.92

Ref: 10-F498139