CAS 1234616-73-9
:4-Chloro-1,8-naphthyridine-3-carbonitrile
Description:
4-Chloro-1,8-naphthyridine-3-carbonitrile is a heterocyclic organic compound characterized by its naphthyridine core, which features a chlorine substituent at the 4-position and a cyano group at the 3-position. This compound belongs to a class of compounds known for their diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the cyano group contributes to its reactivity and can facilitate further chemical modifications. The chlorine atom enhances the compound's lipophilicity, potentially influencing its interaction with biological targets. Additionally, the naphthyridine structure is known for its ability to participate in various chemical reactions, making it a valuable scaffold in medicinal chemistry. The compound's physical properties, such as solubility and melting point, can vary depending on the solvent and conditions, but it is generally expected to exhibit moderate solubility in organic solvents. Overall, 4-Chloro-1,8-naphthyridine-3-carbonitrile is a significant compound in research due to its structural features and potential applications.
Formula:C9H4ClN3
InChI:InChI=1S/C9H4ClN3/c10-8-6(4-11)5-13-9-7(8)2-1-3-12-9/h1-3,5H
InChI key:InChIKey=UIEOYAUPKYAWEB-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=CC1C#N)N=CC=C2
Synonyms:- 1,8-Naphthyridine-3-carbonitrile, 4-chloro-
- 4-Chloro-1,8-naphthyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
