CAS 1234616-75-1

4-Nitro-1H-pyrazolo[3,4-b]pyridine

Description:

4-Nitro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 4-position of the pyrazole ring enhances its reactivity and potential for various chemical transformations. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in polar organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may also exhibit interesting electronic properties owing to the conjugated system formed by the fused rings. Additionally, it is important to handle this substance with care, as nitro compounds can be sensitive and may pose health risks if not managed properly. Overall, 4-Nitro-1H-pyrazolo[3,4-b]pyridine represents a valuable compound in the field of organic synthesis and drug discovery.

Formula: C₆H₄N₄O₂

InChI: InChI=1S/C6H4N4O2/c11-10(12)5-1-2-7-6-4(5)3-8-9-6/h1-3H,(H,7,8,9)

InChI key: InChIKey=KFUONTSQILUGSY-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(NN=C2)=NC=C1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine, 4-nitro-
• 4-Nitro-1H-pyrazolo[3,4-b]pyridine