CAS 123465-67-8

p-Aminosalicylic acid magnesium salt

Description:

p-Aminosalicylic acid magnesium salt is a chemical compound derived from p-aminosalicylic acid, which is known for its use in the treatment of tuberculosis. This salt form typically exhibits enhanced solubility and bioavailability compared to its parent compound. The magnesium salt is characterized by its ability to provide magnesium ions, which are essential for various biological processes, including enzyme function and cellular metabolism. The compound is generally white to off-white in appearance and may be hygroscopic, meaning it can absorb moisture from the air. It is soluble in water, which facilitates its use in pharmaceutical formulations. The presence of both amino and carboxylic acid functional groups contributes to its acidic properties, while the magnesium ion can influence its stability and reactivity. Overall, p-aminosalicylic acid magnesium salt serves as an important therapeutic agent, particularly in the context of antibiotic treatments, and its formulation can be tailored for specific medical applications.

Formula: C₇H₆MgNO₃

InChI: InChI=1/C7H7NO3.Mg/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3,9H,8H2,(H,10,11);/q;+2/p-1

SMILES: c1cc(c(cc1N)O)C(=O)O.[Mg]

Synonyms:

• P-Amino Salicylic Acid Magnesium