CAS 123469-54-5

8-[(Phenylsulfonyl)amino]octanoic acid

Description:

8-[(Phenylsulfonyl)amino]octanoic acid, identified by its CAS number 123469-54-5, is an organic compound characterized by its long carbon chain and the presence of a phenylsulfonyl group. This compound features an octanoic acid backbone, which consists of eight carbon atoms, making it a fatty acid derivative. The phenylsulfonyl group introduces a sulfonamide functionality, which can enhance the compound's solubility and reactivity. Typically, such compounds exhibit properties that may include moderate to high lipophilicity due to the alkyl chain, while the sulfonamide moiety can impart polar characteristics. This dual nature can influence the compound's behavior in biological systems, potentially affecting its pharmacokinetics and interactions with biological targets. Additionally, compounds with similar structures are often investigated for their potential therapeutic applications, including anti-inflammatory or antimicrobial properties. Overall, 8-[(Phenylsulfonyl)amino]octanoic acid represents a unique structure that combines features of both fatty acids and sulfonamides, making it of interest in various chemical and pharmaceutical research contexts.

Formula: C₁₄H₂₁NO₄S

InChI: InChI=1S/C14H21NO4S/c16-14(17)11-7-2-1-3-8-12-15-20(18,19)13-9-5-4-6-10-13/h4-6,9-10,15H,1-3,7-8,11-12H2,(H,16,17)

InChI key: InChIKey=VKNJBICPCNOEJD-UHFFFAOYSA-N

SMILES: S(NCCCCCCCC(O)=O)(=O)(=O)C1=CC=CC=C1

Synonyms:

• Octanoic acid, 8-[(phenylsulfonyl)amino]-
• 8-[(Phenylsulfonyl)amino]octanoic acid

Octanoic acid, 8-[(phenylsulfonyl)amino]-

CAS: 123469-54-5

Formula: C₁₄H₂₁NO₄S

Molecular weight: 299.3858

Ref: IN-DA000KO5