
CAS 1234692-74-0
:4-Pentyn-1-ol, 2-amino-, hydrochloride (1:1), (2S)-
Description:
4-Pentyn-1-ol, 2-amino-, hydrochloride (1:1), (2S)- is a chemical compound characterized by its amine and alcohol functional groups, making it a member of the amino alcohol class. This compound features a pentynyl chain, indicating the presence of a triple bond between the second and third carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The hydrochloride form suggests that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. The (2S) designation indicates that the compound has a specific stereochemistry at the second carbon, which can influence its biological activity and interaction with other molecules. Typically, amino alcohols like this one are of interest in medicinal chemistry and can serve as intermediates in the synthesis of pharmaceuticals or as chiral building blocks in organic synthesis. Its CAS number, 1234692-74-0, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry.
Formula:C5H9NO·ClH
InChI:InChI=1S/C5H9NO.ClH/c1-2-3-5(6)4-7;/h1,5,7H,3-4,6H2;1H/t5-;/m0./s1
InChI key:InChIKey=YRVZFZKRMMQRAM-JEDNCBNOSA-N
SMILES:[C@H](CC#C)(CO)N.Cl
Synonyms:- 4-Pentyn-1-ol, 2-amino-, hydrochloride (1:1), (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-propargylglycinol hydrochloride
CAS:(S)-propargylglycinol hydrochlorideMolecular weight:135.59g/mol
