CAS 123470-16-6
:3,4-dihydro-1H-isothiochromen-4-amine hydrochloride
Description:
3,4-Dihydro-1H-isothiochromen-4-amine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a cyclohexene. This compound features an amine functional group, contributing to its potential biological activity. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, particularly in pharmaceutical contexts. The presence of the isothiochromene moiety suggests potential interactions with biological targets, which may be of interest in medicinal chemistry. Its molecular structure allows for various substitution patterns, which can influence its pharmacological properties. As with many amines, it may exhibit basicity, and its hydrochloride form typically indicates a stable, crystalline solid at room temperature. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies may be required to fully elucidate its properties, including its reactivity, stability, and potential therapeutic applications.
Formula:C9H12ClNS
InChI:InChI=1/C9H11NS.ClH/c10-9-6-11-5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H
SMILES:c1ccc2c(c1)CSCC2N.Cl
Synonyms:- 1H-2-Benzothiopyran-4-amine, 3,4-dihydro-, hydrochloride (1:1)
- 3,4-Dihydro-1H-isothiochromen-4-amine hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,4-Dihydro-1h-isothiochromen-4-amine, HCl
CAS:Formula:C9H11NSColor and Shape:SolidMolecular weight:165.2553
