CAS 123470-46-2
:4,5-difluorobenzene-1,2-diamine dihydrochloride
Description:
4,5-Difluorobenzene-1,2-diamine dihydrochloride is a chemical compound characterized by its structure, which includes a benzene ring substituted with two fluorine atoms at the 4 and 5 positions and two amino groups at the 1 and 2 positions. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in organic synthesis and medicinal chemistry. The presence of fluorine atoms can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. As a diamine, it can participate in various chemical reactions, including coupling reactions and the formation of polymers. Safety data sheets indicate that, like many amines, it may be harmful if ingested or inhaled, and appropriate safety measures should be taken when handling it. Its specific applications may vary, but it is often explored in the context of pharmaceuticals and agrochemicals due to its unique structural features.
Formula:C6H8Cl2F2N2
InChI:InChI=1/C6H6F2N2.2ClH/c7-3-1-5(9)6(10)2-4(3)8;;/h1-2H,9-10H2;2*1H
SMILES:c1c(c(cc(c1N)N)F)F.Cl.Cl
Synonyms:- 1,2-Benzenediamine, 4,5-Difluoro-, Hydrochloride (1:2)
- 4,5-Difluoro-1,2-benzenediamine dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2-Benzenediamine, 4,5-difluoro-, hydrochloride (1:2)
CAS:Formula:C6H8Cl2F2N2Molecular weight:217.0439
