CAS 1234710-01-0

2-(3-Azetidinyl)-1H-imidazole

Description:

2-(3-Azetidinyl)-1H-imidazole is a chemical compound characterized by its unique structure, which includes an imidazole ring and an azetidine moiety. The imidazole ring is a five-membered heterocyclic structure containing two nitrogen atoms, contributing to its basicity and potential for forming coordination complexes. The azetidine group, a four-membered cyclic amine, adds to the compound's reactivity and can influence its pharmacological properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties, such as solubility, stability, and reactivity, can be influenced by the presence of functional groups and the overall molecular conformation. Additionally, the compound's interactions with biological targets can be studied to assess its potential therapeutic applications. As with many heterocyclic compounds, the synthesis and characterization of 2-(3-Azetidinyl)-1H-imidazole are crucial for understanding its behavior in various chemical environments and its potential uses in drug development.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-2-9-6(8-1)5-3-7-4-5/h1-2,5,7H,3-4H2,(H,8,9)

InChI key: InChIKey=FUUJTHNKOCYTDT-UHFFFAOYSA-N

SMILES: C1(CNC1)C=2NC=CN2

Synonyms:

• 2-(Azetidin-3-yl)-1H-imidazole
• 2-(3-Azetidinyl)-1H-imidazole
• 1H-Imidazole, 2-(3-azetidinyl)-