CAS 123476-71-1
:3-(4-Chlorophenyl)-4-phenyl-5(4H)-isoxazolone
Description:
3-(4-Chlorophenyl)-4-phenyl-5(4H)-isoxazolone, identified by its CAS number 123476-71-1, is a chemical compound characterized by its isoxazolone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with aromaticity due to the presence of phenyl groups, which can influence its reactivity and stability. The chlorophenyl substituent introduces electron-withdrawing characteristics, potentially affecting the compound's electronic properties and reactivity in chemical reactions. Isoxazolones are known for their biological activity, and this particular compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose environmental and health risks. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action.
Formula:C15H10ClNO2
InChI:InChI=1S/C15H10ClNO2/c16-12-8-6-11(7-9-12)14-13(15(18)19-17-14)10-4-2-1-3-5-10/h1-9,13H
InChI key:InChIKey=VAMCWKLKPVSATP-UHFFFAOYSA-N
SMILES:O=C1C(C(=NO1)C2=CC=C(Cl)C=C2)C3=CC=CC=C3
Synonyms:- 3-(4-Chlorophenyl)-4-phenyl-5(4H)-isoxazolone
- 5(4H)-Isoxazolone, 3-(4-chlorophenyl)-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
