CAS 123496-28-6
:histamine-releasing peptide
Description:
Histamine-releasing peptide (HRP) is a biologically active substance known for its role in the immune response and allergic reactions. It is a peptide that can stimulate the release of histamine from mast cells, which are crucial in mediating inflammatory processes. HRP is typically involved in various physiological functions, including modulation of immune responses and regulation of vascular permeability. The peptide is characterized by its ability to bind to specific receptors on mast cells, triggering degranulation and subsequent histamine release. This action can lead to various effects, such as vasodilation, increased gastric acid secretion, and bronchoconstriction, which are commonly associated with allergic reactions. HRP is also studied for its potential implications in conditions like asthma and other allergic diseases. Its molecular structure and sequence contribute to its biological activity, making it a subject of interest in pharmacological research and therapeutic applications. Understanding HRP's characteristics can provide insights into its role in health and disease, particularly in the context of allergic and inflammatory responses.
Formula:C50H74N16O10
InChI:InChI=1/C50H74N16O10/c1-4-28(2)40(51)46(73)60-29(3)41(68)61-34(13-8-20-57-49(52)53)42(69)62-35(14-9-21-58-50(54)55)43(70)64-37(25-32-26-56-27-59-32)47(74)66-22-10-15-39(66)45(72)63-36(23-31-16-18-33(67)19-17-31)44(71)65-38(48(75)76)24-30-11-6-5-7-12-30/h5-7,11-12,16-19,26-29,34-40,67H,4,8-10,13-15,20-25,51H2,1-3H3,(H,56,59)(H,60,73)(H,61,68)(H,62,69)(H,63,72)(H,64,70)(H,65,71)(H,75,76)(H4,52,53,57)(H4,54,55,58)/t28-,29-,34-,35-,36-,37-,38-,39-,40-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H](C)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1cnc[nH]1)C(=O)N1CCC[C@H]1C(=N[C@@H](Cc1ccc(cc1)O)C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)O)O)O)O)N
Synonyms:- 9-De-L-leucinekinetensin (human)
- Ile-ala-arg-arg-his-pro-tyr-pro-tyr-phe
- Isoleucyl-alanyl-arginyl-arginyl-histidyl-prolyl-tyrosyl-prolyl-tyrosyl-phenylalanine
- Kinetensin (human), 9-de-L-leucine-
- L-isoleucyl-L-alanyl-N~5~-(diaminomethylidene)-L-ornithyl-N~5~-(diaminomethylidene)-L-ornithyl-L-histidyl-L-prolyl-L-tyrosyl-L-phenylalanine
- Histamine-releasing peptide
- Kinetensin 1-8
- L-Phenylalanine, L-isoleucyl-L-alanyl-L-arginyl-L-arginyl-L-histidyl-L-prolyl-L-tyrosyl-
- (Des-Leu9)-Kinetensin H-Ile-Ala-Arg-Arg-His-Pro-Tyr-Phe-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(Des-Leu9)-Kinetensin
CAS:(Des-Leu9)-Kinetensin H-Ile-Ala-Arg-Arg-His-Pro-Tyr-Phe-OH is an analog of kinetensin, a peptide hormone that stimulates pancreatic exocrine secretions. (Des-Leu9)-Kinetensin H-Ile-Ala-Arg-Arg-His-Pro-Tyr-Phe has been shown to have a specific interaction with the albumin protein, which is the major plasma protein in humans. This peptide can inhibit protein synthesis and may be used as a treatment for chronic renal failure, cystic fibrosis, malignant hypertension, and other conditions. The sequence of this peptide is homologous to the sequence of human kinetensin. Electron microscopic analysis showed that it has a hydrophobic side chain and an amphipathic structure.
Formula:C50H74N16O10Purity:Min. 95%Molecular weight:1,059.22 g/mol
