CymitQuimica logo

CAS 123502-57-8

:

Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]-

Description:
Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]- is a complex polymeric compound characterized by its polyether backbone and functional groups that include pyrrolidinyl moieties. This substance exhibits properties typical of polyethers, such as good solubility in various solvents and potential biocompatibility, making it suitable for applications in pharmaceuticals and biotechnology. The presence of the pyrrolidinyl groups suggests that it may have specific interactions with biological systems, potentially enhancing its utility in drug delivery or as a stabilizing agent in formulations. Additionally, the dioxo groups indicate that the compound may participate in various chemical reactions, including those involving nucleophilic attack or hydrogen bonding. Overall, this compound's unique structure and functionalization contribute to its versatility in various chemical and industrial applications, particularly in the fields of materials science and medicinal chemistry.
Formula:(C2H4O)nC14H16N2O9
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.