CAS 123506-69-4

3-Methoxy-4-methyl-2-pyridinecarboxaldehyde

Description:

3-Methoxy-4-methyl-2-pyridinecarboxaldehyde, with the CAS number 123506-69-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the pyridine ring, as well as an aldehyde functional group (-CHO) at the 2-position. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic syntheses. Its methoxy and methyl substituents can influence its solubility and reactivity, making it of interest in synthetic organic chemistry and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which warrants further investigation for applications in medicinal chemistry. Proper handling and storage are essential due to its reactive nature and potential health hazards.

Formula: C₈H₉NO₂

InChI: InChI=1S/C8H9NO2/c1-6-3-4-9-7(5-10)8(6)11-2/h3-5H,1-2H3

InChI key: InChIKey=LCBGLWHTPALGJO-UHFFFAOYSA-N

SMILES: C(=O)C1=C(OC)C(C)=CC=N1

Synonyms:

• 2-Pyridinecarboxaldehyde, 3-methoxy-4-methyl-
• 3-Methoxy-4-methyl-2-pyridinecarboxaldehyde
• 3-Methoxy-4-methylpyridine-2-carbaldehyde