CAS 123511-50-2
:1-Propyl-1H-benzimidazole-2-carboxaldehyde
Description:
1-Propyl-1H-benzimidazole-2-carboxaldehyde is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a propyl group attached to the nitrogen atom of the benzimidazole and an aldehyde functional group at the 2-position of the benzimidazole ring. The presence of the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the presence of both the propyl group and the aldehyde may influence its biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-2-7-13-10-6-4-3-5-9(10)12-11(13)8-14/h3-6,8H,2,7H2,1H3
InChI key:InChIKey=YQXBQNVSLZRMGK-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(N=C1C=O)=CC=CC2
Synonyms:- 1-Propyl-1H-benzoimidazole-2-carbaldehyde
- 1H-Benzimidazole-2-carboxaldehyde, 1-propyl-
- 1-Propylbenzimidazole-2-carbaldehyde
- 1-Propyl-1H-1,3-benzodiazole-2-carbaldehyde
- 1-Propyl-1H-benzimidazole-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.