
CAS 123511-51-3
:1-Methyl-4-phenyl-1H-imidazole-2-carboxaldehyde
Description:
1-Methyl-4-phenyl-1H-imidazole-2-carboxaldehyde is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl group and a phenyl group, contributing to its unique properties and reactivity. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. It is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other fine chemicals. The compound's solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Additionally, its molecular structure suggests potential biological activity, which may warrant further investigation in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-13-7-10(12-11(13)8-14)9-5-3-2-4-6-9/h2-8H,1H3
InChI key:InChIKey=DGQFWZBGEVSOQG-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(=CN1C)C2=CC=CC=C2
Synonyms:- 1-Methyl-4-phenylimidazole-2-carboxaldehyde
- 1-Methyl-4-phenyl-1H-imidazole-2-carboxaldehyde
- 1H-Imidazole-2-carboxaldehyde, 1-methyl-4-phenyl-
- 1-Methyl-4-phenyl-1H-imidazole-2-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.