CAS 123524-53-8

[1,1′-Binaphthalene]-4,4′-dicarboxylic acid

Description:

[1,1′-Binaphthalene]-4,4′-dicarboxylic acid, with the CAS number 123524-53-8, is an organic compound characterized by its structure, which consists of two naphthalene rings connected by a central carbon atom, with carboxylic acid functional groups (-COOH) attached at the 4 and 4' positions. This compound is notable for its potential applications in organic synthesis, particularly in the development of chiral ligands and catalysts due to its rigid, planar structure that can facilitate stereochemical control in reactions. The presence of the carboxylic acid groups enhances its solubility in polar solvents and allows for potential interactions in various chemical environments. Additionally, [1,1′-Binaphthalene]-4,4′-dicarboxylic acid can participate in hydrogen bonding and other intermolecular interactions, making it useful in materials science and supramolecular chemistry. Its unique properties also make it a candidate for studies in organic electronics and photonics, where its electronic characteristics can be exploited for device applications.

Formula: C₂₂H₁₄O₄

InChI: InChI=1S/C22H14O4/c23-21(24)19-11-9-17(13-5-1-3-7-15(13)19)18-10-12-20(22(25)26)16-8-4-2-6-14(16)18/h1-12H,(H,23,24)(H,25,26)

InChI key: InChIKey=LPJFECYYLUQKSO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C(=CC1)C=3C4=C(C(C(O)=O)=CC3)C=CC=C4)C=CC=C2

Synonyms:

• [1,1′-Binaphthalene]-4,4′-dicarboxylic acid

[1,1′-Binaphthalene]-4,4′-dicarboxylic acid

CAS: 123524-53-8

Formula: C₂₂H₁₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 342.3442

Ref: IN-DA01PIPT

[1,1'-Binaphthalene]-4,4'-dicarboxylic acid

CAS: 123524-53-8

[1,1'-Binaphthalene]-4,4'-dicarboxylic acid

Purity: 97%

Molecular weight: 342.34g/mol

Ref: 54-OR81206

[1,1′-Binaphthalene]-4,4′-dicarboxylic acid

CAS: 123524-53-8

Purity: 98%

Molecular weight: 342.3500061

Ref: 10-F619599