
CAS 123530-68-7
:2-Propenoic acid, 3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-, (E)-
Description:
2-Propenoic acid, 3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-, (E)-, also known by its CAS number 123530-68-7, is an organic compound characterized by its structure, which features a propenoic acid moiety and a pyrrolopyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It possesses a carboxylic acid functional group, which imparts acidic properties and allows for potential reactivity in various chemical reactions, such as esterification or polymerization. The presence of the pyrrolopyridine structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The (E)-configuration indicates the specific geometric arrangement of substituents around the double bond, which can influence its reactivity and interaction with biological targets. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c13-9(14)4-3-7-6-12-10-8(7)2-1-5-11-10/h1-6H,(H,11,12)(H,13,14)/b4-3+
InChI key:InChIKey=IDRPICVEEDJIGZ-ONEGZZNKSA-N
SMILES:C(=C/C(O)=O)\C=1C=2C(NC1)=NC=CC2
Synonyms:- 2-Propenoic acid, 3-(1H-pyrrolo[2,3-b]pyridin-3-yl)-, (E)-
- 1H-Pyrrolo[2,3-b]pyridine, 2-propenoic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.